C18H7ClF5N3O3 — CID 54577975
N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2,3,6-trifluorobenzamide (PubChem CID 54577975) has the molecular formula C18H7ClF5N3O3 and a molecular weight of 443.72 g/mol. Its IUPAC name is N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2,3,6-trifluorobenzamide.
| Compound Name | N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2,3,6-trifluorobenzamide |
|---|---|
| PubChem CID | 54577975 |
| Molecular Formula | C18H7ClF5N3O3 |
| Molecular Weight | 443.72 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-2,3,6-trifluorobenzamide |
| SMILES | O=C(Nc1cnc(-c2cc3c(cc2Cl)OC(F)(F)O3)cn1)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C18H7ClF5N3O3/c19-8-4-13-12(29-18(23,24)30-13)3-7(8)11-5-26-14(6-25-11)27-17(28)15-9(20)1-2-10(21)16(15)22/h1-6H,(H,26,27,28) |
| InChIKey | ZTIOXGWBAOQJEY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|