About N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide
N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide (PubChem CID 54577977) has the molecular formula C19H11ClF3N3O3
and a molecular weight of 421.76 g/mol. Its IUPAC name is N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide.
Molecular Properties
| Compound Name | N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide |
| PubChem CID | 54577977 |
| Molecular Formula | C19H11ClF3N3O3 |
| Molecular Weight | 421.76 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide |
| SMILES | Cc1c(F)cccc1C(=O)Nc1cnc(-c2cc3c(cc2Cl)OC(F)(F)O3)cn1 |
| InChI | InChI=1S/C19H11ClF3N3O3/c1-9-10(3-2-4-13(9)21)18(27)26-17-8-24-14(7-25-17)11-5-15-16(6-12(11)20)29-19(22,23)28-15/h2-8H,1H3,(H,25,26,27) |
| InChIKey | BFEOOLOHDCIKKG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.76 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide?
The IUPAC name of N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide (CID 54577977) is N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide.
What is the SMILES notation for N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide?
The canonical SMILES for N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide is Cc1c(F)cccc1C(=O)Nc1cnc(-c2cc3c(cc2Cl)OC(F)(F)O3)cn1.
What is the InChIKey of N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide?
The InChIKey is BFEOOLOHDCIKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClF3N3O3/c1-9-10(3-2-4-13(9)21)18(27)26-17-8-24-14(7-25-17)11-5-15-16(6-12(11)20)29-19(22,23)28-15/h2-8H,1H3,(H,25,26,27).
What are the key properties of N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide?
N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide has a molecular weight of 421.76 g/mol, XLogP of 4.82, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(6-chloro-2,2-difluoro-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylbenzamide is sourced from PubChem (CID 54577977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).