C23H18N6O — CID 54578057
2-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-4-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]benzonitrile (PubChem CID 54578057) has the molecular formula C23H18N6O and a molecular weight of 394.44 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-4-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]benzonitrile.
| Compound Name | 2-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-4-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 54578057 |
| Molecular Formula | C23H18N6O |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[3-[(E)-2-cyanoethenyl]-5-methylphenoxy]-4-[(4-cyclopropyl-1,3,5-triazin-2-yl)amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(Oc2cc(Nc3ncnc(C4CC4)n3)ccc2C#N)c1 |
| InChI | InChI=1S/C23H18N6O/c1-15-9-16(3-2-8-24)11-20(10-15)30-21-12-19(7-6-18(21)13-25)28-23-27-14-26-22(29-23)17-4-5-17/h2-3,6-7,9-12,14,17H,4-5H2,1H3,(H,26,27,28,29)/b3-2+ |
| InChIKey | HKJDRZXBZJNMBB-NSCUHMNNSA-N |
| XLogP | 5.00 |
| TPSA | 107.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|