C40H75NO7Si3 — CID 54578143
(4R)-4-benzyl-3-[(2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one (PubChem CID 54578143) has the molecular formula C40H75NO7Si3 and a molecular weight of 766.30 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54578143 |
| Molecular Formula | C40H75NO7Si3 |
| Molecular Weight | 766.30 g/mol |
| Exact Mass | 765.49 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-2,6-dimethyl-5-triethylsilyloxynonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C40H75NO7Si3/c1-17-51(18-2,19-3)48-35(40(11,44-12)26-23-27-46-49(13,14)38(5,6)7)29-34(47-50(15,16)39(8,9)10)31(4)36(42)41-33(30-45-37(41)43)28-32-24-21-20-22-25-32/h20-22,24-25,31,33-35H,17-19,23,26-30H2,1-16H3/t31-,33-,34+,35-,40-/m1/s1 |
| InChIKey | MCPAXJMEUSQEGJ-MVBZHHIZSA-N |
| XLogP | 10.59 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.30 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|