About tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate
tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate (PubChem CID 54578221) has the molecular formula C43H43NO10
and a molecular weight of 733.81 g/mol. Its IUPAC name is tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate |
| PubChem CID | 54578221 |
| Molecular Formula | C43H43NO10 |
| Molecular Weight | 733.81 g/mol |
| Exact Mass | 733.29 |
| IUPAC Name | tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1)CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1 |
| InChI | InChI=1S/C43H43NO10/c1-43(2,3)54-42(47)44(20-22-48-24-26-50-32-16-12-30(13-17-32)40-28-36(45)34-8-4-6-10-38(34)52-40)21-23-49-25-27-51-33-18-14-31(15-19-33)41-29-37(46)35-9-5-7-11-39(35)53-41/h4-19,28-29H,20-27H2,1-3H3 |
| InChIKey | ZPXIIMMDBQCBET-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 126.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 733.81 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate?
The IUPAC name of tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate (CID 54578221) is tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate.
What is the SMILES notation for tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate?
The canonical SMILES for tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate is CC(C)(C)OC(=O)N(CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1)CCOCCOc1ccc(-c2cc(=O)c3ccccc3o2)cc1.
What is the InChIKey of tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate?
The InChIKey is ZPXIIMMDBQCBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H43NO10/c1-43(2,3)54-42(47)44(20-22-48-24-26-50-32-16-12-30(13-17-32)40-28-36(45)34-8-4-6-10-38(34)52-40)21-23-49-25-27-51-33-18-14-31(15-19-33)41-29-37(46)35-9-5-7-11-39(35)53-41/h4-19,28-29H,20-27H2,1-3H3.
What are the key properties of tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate?
tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate has a molecular weight of 733.81 g/mol, XLogP of 7.96, 16 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N,N-bis[2-[2-[4-(4-oxochromen-2-yl)phenoxy]ethoxy]ethyl]carbamate is sourced from PubChem (CID 54578221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).