C25H38O6 — CID 54578510
(11'S,12'R,15'S,16'S)-11',15'-bis(methoxymethoxy)-16'-methylspiro[1,3-dioxolane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene] (PubChem CID 54578510) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is (11'S,12'R,15'S,16'S)-11',15'-bis(methoxymethoxy)-16'-methylspiro[1,3-dioxolane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene].
| Compound Name | (11'S,12'R,15'S,16'S)-11',15'-bis(methoxymethoxy)-16'-methylspiro[1,3-dioxolane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene] |
|---|---|
| PubChem CID | 54578510 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (11'S,12'R,15'S,16'S)-11',15'-bis(methoxymethoxy)-16'-methylspiro[1,3-dioxolane-2,6'-tetracyclo[9.7.0.03,8.012,16]octadeca-1(18),2-diene] |
| SMILES | COCO[C@H]1CC[C@@H]2[C@]1(C)CC=C1C=C3CCC4(CC3CC[C@@]12OCOC)OCCO4 |
| InChI | InChI=1S/C25H38O6/c1-23-9-8-20-14-18-6-10-24(29-12-13-30-24)15-19(18)7-11-25(20,31-17-27-3)21(23)4-5-22(23)28-16-26-2/h8,14,19,21-22H,4-7,9-13,15-17H2,1-3H3/t19?,21-,22+,23+,25-/m1/s1 |
| InChIKey | WOGHCEPVBLYVKA-VASVWSGJSA-N |
| XLogP | 4.34 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|