C21H33N3O5Si — CID 54578563
triethoxy-[3-[4-[[(2S,3S)-3-phenyloxiran-2-yl]methoxymethyl]triazol-1-yl]propyl]silane (PubChem CID 54578563) has the molecular formula C21H33N3O5Si and a molecular weight of 435.60 g/mol. Its IUPAC name is triethoxy-[3-[4-[[(2S,3S)-3-phenyloxiran-2-yl]methoxymethyl]triazol-1-yl]propyl]silane.
| Compound Name | triethoxy-[3-[4-[[(2S,3S)-3-phenyloxiran-2-yl]methoxymethyl]triazol-1-yl]propyl]silane |
|---|---|
| PubChem CID | 54578563 |
| Molecular Formula | C21H33N3O5Si |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | triethoxy-[3-[4-[[(2S,3S)-3-phenyloxiran-2-yl]methoxymethyl]triazol-1-yl]propyl]silane |
| SMILES | CCO[Si](CCCn1cc(COC[C@@H]2O[C@H]2c2ccccc2)nn1)(OCC)OCC |
| InChI | InChI=1S/C21H33N3O5Si/c1-4-26-30(27-5-2,28-6-3)14-10-13-24-15-19(22-23-24)16-25-17-20-21(29-20)18-11-8-7-9-12-18/h7-9,11-12,15,20-21H,4-6,10,13-14,16-17H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | UTTVSKUXQNNQQS-SFTDATJTSA-N |
| XLogP | 3.37 |
| TPSA | 80.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|