C19H32O7 — CID 54578590
(3R,4S,6R,7R,11E,13S,14R)-14-ethyl-4,6,13-trihydroxy-7-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione (PubChem CID 54578590) has the molecular formula C19H32O7 and a molecular weight of 372.46 g/mol. Its IUPAC name is (3R,4S,6R,7R,11E,13S,14R)-14-ethyl-4,6,13-trihydroxy-7-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione.
| Compound Name | (3R,4S,6R,7R,11E,13S,14R)-14-ethyl-4,6,13-trihydroxy-7-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione |
|---|---|
| PubChem CID | 54578590 |
| Molecular Formula | C19H32O7 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | (3R,4S,6R,7R,11E,13S,14R)-14-ethyl-4,6,13-trihydroxy-7-methoxy-3,7,13-trimethyl-1-oxacyclotetradec-11-ene-2,10-dione |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O)C[C@@H](O)[C@](C)(OC)CCC(=O)/C=C/[C@]1(C)O |
| InChI | InChI=1S/C19H32O7/c1-6-16-18(3,24)9-7-13(20)8-10-19(4,25-5)15(22)11-14(21)12(2)17(23)26-16/h7,9,12,14-16,21-22,24H,6,8,10-11H2,1-5H3/b9-7+/t12-,14+,15-,16-,18+,19-/m1/s1 |
| InChIKey | ZNQIGWJWOYIOIN-SMJDVGNDSA-N |
| XLogP | 1.13 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |