C14H10N2O4 — CID 54578711
3-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1,4,2-dioxazole (PubChem CID 54578711) has the molecular formula C14H10N2O4 and a molecular weight of 270.24 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1,4,2-dioxazole.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1,4,2-dioxazole |
|---|---|
| PubChem CID | 54578711 |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-5-pyridin-2-yl-1,4,2-dioxazole |
| SMILES | c1ccc(C2ON=C(c3ccc4c(c3)OCO4)O2)nc1 |
| InChI | InChI=1S/C14H10N2O4/c1-2-6-15-10(3-1)14-19-13(16-20-14)9-4-5-11-12(7-9)18-8-17-11/h1-7,14H,8H2 |
| InChIKey | MQBYETZXMMOZRY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 62.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |