About N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide
N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide (PubChem CID 54579006) has the molecular formula C20H16Cl2FN3O2
and a molecular weight of 420.27 g/mol. Its IUPAC name is N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide.
Molecular Properties
| Compound Name | N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide |
| PubChem CID | 54579006 |
| Molecular Formula | C20H16Cl2FN3O2 |
| Molecular Weight | 420.27 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide |
| SMILES | CC(Oc1cc(NC(=O)c2ccccc2)cnc1N)c1c(Cl)ccc(F)c1Cl |
| InChI | InChI=1S/C20H16Cl2FN3O2/c1-11(17-14(21)7-8-15(23)18(17)22)28-16-9-13(10-25-19(16)24)26-20(27)12-5-3-2-4-6-12/h2-11H,1H3,(H2,24,25)(H,26,27) |
| InChIKey | VMYRSZYEJHEZMA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.27 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide?
The IUPAC name of N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide (CID 54579006) is N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide.
What is the SMILES notation for N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide?
The canonical SMILES for N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide is CC(Oc1cc(NC(=O)c2ccccc2)cnc1N)c1c(Cl)ccc(F)c1Cl.
What is the InChIKey of N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide?
The InChIKey is VMYRSZYEJHEZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl2FN3O2/c1-11(17-14(21)7-8-15(23)18(17)22)28-16-9-13(10-25-19(16)24)26-20(27)12-5-3-2-4-6-12/h2-11H,1H3,(H2,24,25)(H,26,27).
What are the key properties of N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide?
N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide has a molecular weight of 420.27 g/mol, XLogP of 5.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-amino-5-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]benzamide is sourced from PubChem (CID 54579006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).