C28H36FN3O2 — CID 54579546
[(1S)-1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butyl] butanoate (PubChem CID 54579546) has the molecular formula C28H36FN3O2 and a molecular weight of 465.61 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butyl] butanoate.
| Compound Name | [(1S)-1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butyl] butanoate |
|---|---|
| PubChem CID | 54579546 |
| Molecular Formula | C28H36FN3O2 |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butyl] butanoate |
| SMILES | CCCC(=O)O[C@@H](CCCN1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3C)c1ccc(F)cc1 |
| InChI | InChI=1S/C28H36FN3O2/c1-3-6-27(33)34-26(20-10-12-21(29)13-11-20)9-5-15-31-16-14-24-23(19-31)22-7-4-8-25-28(22)32(24)18-17-30(25)2/h4,7-8,10-13,23-24,26H,3,5-6,9,14-19H2,1-2H3/t23-,24-,26-/m0/s1 |
| InChIKey | DOTXCKUFMQSKTM-GNKBHMEESA-N |
| XLogP | 5.12 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |