About 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine
2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 54579820) has the molecular formula C13H7N3OS
and a molecular weight of 253.29 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine |
| PubChem CID | 54579820 |
| Molecular Formula | C13H7N3OS |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | c1cnc2nc(-c3ccc4ncsc4c3)oc2c1 |
| InChI | InChI=1S/C13H7N3OS/c1-2-10-12(14-5-1)16-13(17-10)8-3-4-9-11(6-8)18-7-15-9/h1-7H |
| InChIKey | PGEFANMDQUBHRB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine?
The IUPAC name of 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine (CID 54579820) is 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine.
What is the SMILES notation for 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine?
The canonical SMILES for 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine is c1cnc2nc(-c3ccc4ncsc4c3)oc2c1.
What is the InChIKey of 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine?
The InChIKey is PGEFANMDQUBHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7N3OS/c1-2-10-12(14-5-1)16-13(17-10)8-3-4-9-11(6-8)18-7-15-9/h1-7H.
What are the key properties of 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine?
2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine has a molecular weight of 253.29 g/mol, XLogP of 3.50, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-6-yl)-[1,3]oxazolo[4,5-b]pyridine is sourced from PubChem (CID 54579820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).