C19H20ClNO4S — CID 54580059
17-chloro-1-hydroxy-2,5-dimethyl-7-oxa-3-thia-13-azatetracyclo[11.6.1.02,6.014,19]icosa-5,14(19),15,17-tetraene-4,20-dione (PubChem CID 54580059) has the molecular formula C19H20ClNO4S and a molecular weight of 393.89 g/mol. Its IUPAC name is 17-chloro-1-hydroxy-2,5-dimethyl-7-oxa-3-thia-13-azatetracyclo[11.6.1.02,6.014,19]icosa-5,14(19),15,17-tetraene-4,20-dione.
| Compound Name | 17-chloro-1-hydroxy-2,5-dimethyl-7-oxa-3-thia-13-azatetracyclo[11.6.1.02,6.014,19]icosa-5,14(19),15,17-tetraene-4,20-dione |
|---|---|
| PubChem CID | 54580059 |
| Molecular Formula | C19H20ClNO4S |
| Molecular Weight | 393.89 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 17-chloro-1-hydroxy-2,5-dimethyl-7-oxa-3-thia-13-azatetracyclo[11.6.1.02,6.014,19]icosa-5,14(19),15,17-tetraene-4,20-dione |
| SMILES | CC1=C2OCCCCCN3C(=O)C(O)(c4cc(Cl)ccc43)C2(C)SC1=O |
| InChI | InChI=1S/C19H20ClNO4S/c1-11-15-18(2,26-16(11)22)19(24)13-10-12(20)6-7-14(13)21(17(19)23)8-4-3-5-9-25-15/h6-7,10,24H,3-5,8-9H2,1-2H3 |
| InChIKey | NTVOMOYEEPUNQJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|