C20H20Cl2OS2 — CID 54580178
(2'E)-2'-[(3,4-dichlorophenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one (PubChem CID 54580178) has the molecular formula C20H20Cl2OS2 and a molecular weight of 411.42 g/mol. Its IUPAC name is (2'E)-2'-[(3,4-dichlorophenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one.
| Compound Name | (2'E)-2'-[(3,4-dichlorophenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
|---|---|
| PubChem CID | 54580178 |
| Molecular Formula | C20H20Cl2OS2 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (2'E)-2'-[(3,4-dichlorophenyl)methylidene]-8'a-methylspiro[1,3-dithiolane-2,6'-3,4,7,8-tetrahydronaphthalene]-1'-one |
| SMILES | CC12CCC3(C=C1CC/C(=C\c1ccc(Cl)c(Cl)c1)C2=O)SCCS3 |
| InChI | InChI=1S/C20H20Cl2OS2/c1-19-6-7-20(24-8-9-25-20)12-15(19)4-3-14(18(19)23)10-13-2-5-16(21)17(22)11-13/h2,5,10-12H,3-4,6-9H2,1H3/b14-10+ |
| InChIKey | KWARJRDWYZWFSX-GXDHUFHOSA-N |
| XLogP | 6.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|