About 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine
2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine (PubChem CID 54580356) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine |
| PubChem CID | 54580356 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine |
| SMILES | NCC[C@@H]1CCOC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C18H21NO2/c19-13-11-17-12-14-20-18(21-17,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17H,11-14,19H2/t17-/m1/s1 |
| InChIKey | CQKOQFUYMKVUOD-QGZVFWFLSA-N |
| XLogP | 3.04 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine?
The IUPAC name of 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine (CID 54580356) is 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine.
What is the SMILES notation for 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine?
The canonical SMILES for 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine is NCC[C@@H]1CCOC(c2ccccc2)(c2ccccc2)O1.
What is the InChIKey of 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine?
The InChIKey is CQKOQFUYMKVUOD-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H21NO2/c19-13-11-17-12-14-20-18(21-17,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17H,11-14,19H2/t17-/m1/s1.
What are the key properties of 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine?
2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine has a molecular weight of 283.37 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4R)-2,2-diphenyl-1,3-dioxan-4-yl]ethanamine is sourced from PubChem (CID 54580356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).