C29H36 — CID 54580360
(3aR,7aR)-2-hexyl-3-phenyl-3a-(1-phenylethenyl)-1,4,5,6,7,7a-hexahydroindene (PubChem CID 54580360) has the molecular formula C29H36 and a molecular weight of 384.61 g/mol. Its IUPAC name is (3aR,7aR)-2-hexyl-3-phenyl-3a-(1-phenylethenyl)-1,4,5,6,7,7a-hexahydroindene.
| Compound Name | (3aR,7aR)-2-hexyl-3-phenyl-3a-(1-phenylethenyl)-1,4,5,6,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 54580360 |
| Molecular Formula | C29H36 |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | (3aR,7aR)-2-hexyl-3-phenyl-3a-(1-phenylethenyl)-1,4,5,6,7,7a-hexahydroindene |
| SMILES | C=C(c1ccccc1)[C@@]12CCCC[C@@H]1CC(CCCCCC)=C2c1ccccc1 |
| InChI | InChI=1S/C29H36/c1-3-4-5-8-19-26-22-27-20-13-14-21-29(27,23(2)24-15-9-6-10-16-24)28(26)25-17-11-7-12-18-25/h6-7,9-12,15-18,27H,2-5,8,13-14,19-22H2,1H3/t27-,29+/m1/s1 |
| InChIKey | VCHOLINCACDFIH-PXJZQJOASA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|