C21H32O2 — CID 54580367
(1R,3S,6Z,11E,15S)-6,11,15-trimethyl-3-prop-1-en-2-yl-16-oxabicyclo[13.1.0]hexadeca-6,11-dien-5-one (PubChem CID 54580367) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1R,3S,6Z,11E,15S)-6,11,15-trimethyl-3-prop-1-en-2-yl-16-oxabicyclo[13.1.0]hexadeca-6,11-dien-5-one.
| Compound Name | (1R,3S,6Z,11E,15S)-6,11,15-trimethyl-3-prop-1-en-2-yl-16-oxabicyclo[13.1.0]hexadeca-6,11-dien-5-one |
|---|---|
| PubChem CID | 54580367 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1R,3S,6Z,11E,15S)-6,11,15-trimethyl-3-prop-1-en-2-yl-16-oxabicyclo[13.1.0]hexadeca-6,11-dien-5-one |
| SMILES | C=C(C)[C@@H]1CC(=O)/C(C)=C\CCC/C(C)=C/CC[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C21H32O2/c1-15(2)18-13-19(22)17(4)11-7-6-9-16(3)10-8-12-21(5)20(14-18)23-21/h10-11,18,20H,1,6-9,12-14H2,2-5H3/b16-10+,17-11-/t18-,20-,21+/m1/s1 |
| InChIKey | OGOAAKPRFPKQQC-XUMGDAJGSA-N |
| XLogP | 5.54 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|