About 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine]
1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] (PubChem CID 545804) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine].
Molecular Properties
| Compound Name | 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] |
| PubChem CID | 545804 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] |
| SMILES | CN1CCC2(C1)Oc1ccccc1O2 |
| InChI | InChI=1S/C11H13NO2/c1-12-7-6-11(8-12)13-9-4-2-3-5-10(9)14-11/h2-5H,6-8H2,1H3 |
| InChIKey | APZDXXRZAVORTA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine]?
The IUPAC name of 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] (CID 545804) is 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine].
What is the SMILES notation for 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine]?
The canonical SMILES for 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] is CN1CCC2(C1)Oc1ccccc1O2.
What is the InChIKey of 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine]?
The InChIKey is APZDXXRZAVORTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-12-7-6-11(8-12)13-9-4-2-3-5-10(9)14-11/h2-5H,6-8H2,1H3.
What are the key properties of 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine]?
1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] has a molecular weight of 191.23 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[1,3-benzodioxole-2,3'-pyrrolidine] is sourced from PubChem (CID 545804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).