C31H29N4O4+ — CID 54580408
17-methoxy-16-[4-(4-phenyltriazol-1-yl)butoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene (PubChem CID 54580408) has the molecular formula C31H29N4O4+ and a molecular weight of 521.60 g/mol. Its IUPAC name is 17-methoxy-16-[4-(4-phenyltriazol-1-yl)butoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene.
| Compound Name | 17-methoxy-16-[4-(4-phenyltriazol-1-yl)butoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
|---|---|
| PubChem CID | 54580408 |
| Molecular Formula | C31H29N4O4+ |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | 17-methoxy-16-[4-(4-phenyltriazol-1-yl)butoxy]-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene |
| SMILES | COc1ccc2cc3[n+](cc2c1OCCCCn1cc(-c2ccccc2)nn1)CCc1cc2c(cc1-3)OCO2 |
| InChI | InChI=1S/C31H29N4O4/c1-36-28-10-9-22-15-27-24-17-30-29(38-20-39-30)16-23(24)11-13-34(27)18-25(22)31(28)37-14-6-5-12-35-19-26(32-33-35)21-7-3-2-4-8-21/h2-4,7-10,15-19H,5-6,11-14,20H2,1H3/q+1 |
| InChIKey | GUPLSJLSLZRHLU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|