C20H16F2N4O — CID 54580488
4-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1H-pyridin-2-one (PubChem CID 54580488) has the molecular formula C20H16F2N4O and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1H-pyridin-2-one.
| Compound Name | 4-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 54580488 |
| Molecular Formula | C20H16F2N4O |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-[(4S,5S)-5-(4-fluorophenyl)-5-(6-fluoro-3-pyridinyl)-4-methyl-1,4-dihydroimidazol-2-yl]-1H-pyridin-2-one |
| SMILES | C[C@@H]1N=C(c2cc[nH]c(=O)c2)N[C@@]1(c1ccc(F)cc1)c1ccc(F)nc1 |
| InChI | InChI=1S/C20H16F2N4O/c1-12-20(14-2-5-16(21)6-3-14,15-4-7-17(22)24-11-15)26-19(25-12)13-8-9-23-18(27)10-13/h2-12H,1H3,(H,23,27)(H,25,26)/t12-,20-/m0/s1 |
| InChIKey | JCZGGLMZFMKEMJ-YUNKPMOVSA-N |
| XLogP | 2.73 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|