C20H27F3N4O3 — CID 54580576
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-morpholin-4-ylethyl)piperazin-2-one (PubChem CID 54580576) has the molecular formula C20H27F3N4O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-morpholin-4-ylethyl)piperazin-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-morpholin-4-ylethyl)piperazin-2-one |
|---|---|
| PubChem CID | 54580576 |
| Molecular Formula | C20H27F3N4O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-(2-morpholin-4-ylethyl)piperazin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCN(CCN2CCOCC2)C(=O)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C20H27F3N4O3/c21-16-12-18(23)17(22)10-14(16)9-15(24)11-19(28)27-4-3-26(20(29)13-27)2-1-25-5-7-30-8-6-25/h10,12,15H,1-9,11,13,24H2/t15-/m1/s1 |
| InChIKey | ZQKSWJKBDAUHHU-OAHLLOKOSA-N |
| XLogP | 0.37 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|