C21H22F3N3O2 — CID 54580577
4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-benzylpiperazin-2-one (PubChem CID 54580577) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-benzylpiperazin-2-one.
| Compound Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-benzylpiperazin-2-one |
|---|---|
| PubChem CID | 54580577 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1-benzylpiperazin-2-one |
| SMILES | N[C@@H](CC(=O)N1CCN(Cc2ccccc2)C(=O)C1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C21H22F3N3O2/c22-17-11-19(24)18(23)9-15(17)8-16(25)10-20(28)27-7-6-26(21(29)13-27)12-14-4-2-1-3-5-14/h1-5,9,11,16H,6-8,10,12-13,25H2/t16-/m1/s1 |
| InChIKey | NZYAICYOZPCDLX-MRXNPFEDSA-N |
| XLogP | 2.23 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|