C27H36O4S — CID 54580674
ethyl 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoate (PubChem CID 54580674) has the molecular formula C27H36O4S and a molecular weight of 456.65 g/mol. Its IUPAC name is ethyl 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoate.
| Compound Name | ethyl 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoate |
|---|---|
| PubChem CID | 54580674 |
| Molecular Formula | C27H36O4S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | ethyl 2-[4-[3-(5,6,7,8-tetrahydronaphthalen-1-yloxy)propoxy]phenyl]sulfanylhexanoate |
| SMILES | CCCCC(Sc1ccc(OCCCOc2cccc3c2CCCC3)cc1)C(=O)OCC |
| InChI | InChI=1S/C27H36O4S/c1-3-5-14-26(27(28)29-4-2)32-23-17-15-22(16-18-23)30-19-9-20-31-25-13-8-11-21-10-6-7-12-24(21)25/h8,11,13,15-18,26H,3-7,9-10,12,14,19-20H2,1-2H3 |
| InChIKey | QXGDTPBHDMFVCC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|