About (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine
(5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine (PubChem CID 54580679) has the molecular formula C25H21BrN4O
and a molecular weight of 473.37 g/mol. Its IUPAC name is (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine.
Molecular Properties
| Compound Name | (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine |
| PubChem CID | 54580679 |
| Molecular Formula | C25H21BrN4O |
| Molecular Weight | 473.37 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine |
| SMILES | CCN(CC)c1ccc2nc3c4ccc(Br)cc4/c(=N/c4ccccn4)cc-3oc2c1 |
| InChI | InChI=1S/C25H21BrN4O/c1-3-30(4-2)17-9-11-20-22(14-17)31-23-15-21(28-24-7-5-6-12-27-24)19-13-16(26)8-10-18(19)25(23)29-20/h5-15H,3-4H2,1-2H3/b28-21+ |
| InChIKey | IENDYHSVYUMONR-SGWCAAJKSA-N |
| XLogP | 6.32 |
| TPSA | 54.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.37 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine?
The IUPAC name of (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine (CID 54580679) is (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine.
What is the SMILES notation for (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine?
The canonical SMILES for (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine is CCN(CC)c1ccc2nc3c4ccc(Br)cc4/c(=N/c4ccccn4)cc-3oc2c1.
What is the InChIKey of (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine?
The InChIKey is IENDYHSVYUMONR-SGWCAAJKSA-N. The full InChI is InChI=1S/C25H21BrN4O/c1-3-30(4-2)17-9-11-20-22(14-17)31-23-15-21(28-24-7-5-6-12-27-24)19-13-16(26)8-10-18(19)25(23)29-20/h5-15H,3-4H2,1-2H3/b28-21+.
What are the key properties of (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine?
(5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine has a molecular weight of 473.37 g/mol, XLogP of 6.32, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-bromo-N,N-diethyl-5-pyridin-2-yliminobenzo[a]phenoxazin-9-amine is sourced from PubChem (CID 54580679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).