C21H24BF2N3 — CID 54580734
4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline (PubChem CID 54580734) has the molecular formula C21H24BF2N3 and a molecular weight of 367.25 g/mol. Its IUPAC name is 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline.
| Compound Name | 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 54580734 |
| Molecular Formula | C21H24BF2N3 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 4-(2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)-N,N-dimethylaniline |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(N(C)C)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C21H24BF2N3/c1-13-11-15(3)26-20(13)19(17-7-9-18(10-8-17)25(5)6)21-14(2)12-16(4)27(21)22(26,23)24/h7-12H,1-6H3 |
| InChIKey | NKARNERAVCKWHA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 11.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|