C26H28N2O3 — CID 54580742
2-[(7R)-7-[methyl(1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 54580742) has the molecular formula C26H28N2O3 and a molecular weight of 416.52 g/mol. Its IUPAC name is 2-[(7R)-7-[methyl(1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[(7R)-7-[methyl(1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 54580742 |
| Molecular Formula | C26H28N2O3 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | 2-[(7R)-7-[methyl(1,2,3,4-tetrahydronaphthalene-1-carbonyl)amino]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | CN(C(=O)C1CCCc2ccccc21)[C@@H]1CCc2c(CC(=O)O)c3ccccc3n2C1 |
| InChI | InChI=1S/C26H28N2O3/c1-27(26(31)21-11-6-8-17-7-2-3-9-19(17)21)18-13-14-24-22(15-25(29)30)20-10-4-5-12-23(20)28(24)16-18/h2-5,7,9-10,12,18,21H,6,8,11,13-16H2,1H3,(H,29,30)/t18-,21?/m1/s1 |
| InChIKey | NCHMLYQLIKIWRI-ITUIMRKVSA-N |
| XLogP | 4.16 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|