About 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid
4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid (PubChem CID 54580794) has the molecular formula C26H29NO5S
and a molecular weight of 467.59 g/mol. Its IUPAC name is 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid.
Molecular Properties
| Compound Name | 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid |
| PubChem CID | 54580794 |
| Molecular Formula | C26H29NO5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid |
| SMILES | O=C(O)CCCc1csc(C(=O)COc2ccc(OCCCCCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C26H29NO5S/c28-24(26-27-21(19-33-26)11-7-12-25(29)30)18-32-23-15-13-22(14-16-23)31-17-6-2-5-10-20-8-3-1-4-9-20/h1,3-4,8-9,13-16,19H,2,5-7,10-12,17-18H2,(H,29,30) |
| InChIKey | QAXNMYSHHDHAJQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 85.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid?
The IUPAC name of 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid (CID 54580794) is 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid.
What is the SMILES notation for 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid?
The canonical SMILES for 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid is O=C(O)CCCc1csc(C(=O)COc2ccc(OCCCCCc3ccccc3)cc2)n1.
What is the InChIKey of 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid?
The InChIKey is QAXNMYSHHDHAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29NO5S/c28-24(26-27-21(19-33-26)11-7-12-25(29)30)18-32-23-15-13-22(14-16-23)31-17-6-2-5-10-20-8-3-1-4-9-20/h1,3-4,8-9,13-16,19H,2,5-7,10-12,17-18H2,(H,29,30).
What are the key properties of 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid?
4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid has a molecular weight of 467.59 g/mol, XLogP of 5.60, 15 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-[4-(5-phenylpentoxy)phenoxy]acetyl]-1,3-thiazol-4-yl]butanoic acid is sourced from PubChem (CID 54580794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).