About 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol
2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol (PubChem CID 54580815) has the molecular formula C19H19N2O+
and a molecular weight of 291.37 g/mol. Its IUPAC name is 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol |
| PubChem CID | 54580815 |
| Molecular Formula | C19H19N2O+ |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol |
| SMILES | CCc1c[n+]2ccc3c4ccccc4[nH]c3c2cc1CCO |
| InChI | InChI=1S/C19H18N2O/c1-2-13-12-21-9-7-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14(13)8-10-22/h3-7,9,11-12,22H,2,8,10H2,1H3/p+1 |
| InChIKey | XHUIUBANZNHJEL-UHFFFAOYSA-O |
| XLogP | 3.16 |
| TPSA | 40.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol?
The IUPAC name of 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol (CID 54580815) is 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol.
What is the SMILES notation for 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol?
The canonical SMILES for 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol is CCc1c[n+]2ccc3c4ccccc4[nH]c3c2cc1CCO.
What is the InChIKey of 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol?
The InChIKey is XHUIUBANZNHJEL-UHFFFAOYSA-O. The full InChI is InChI=1S/C19H18N2O/c1-2-13-12-21-9-7-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14(13)8-10-22/h3-7,9,11-12,22H,2,8,10H2,1H3/p+1.
What are the key properties of 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol?
2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol has a molecular weight of 291.37 g/mol, XLogP of 3.16, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-12H-indolo[2,3-a]quinolizin-5-ium-2-yl)ethanol is sourced from PubChem (CID 54580815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).