C11H23O6S+ — CID 54580835
(2R,3S,4S)-1-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol (PubChem CID 54580835) has the molecular formula C11H23O6S+ and a molecular weight of 283.37 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol.
| Compound Name | (2R,3S,4S)-1-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol |
|---|---|
| PubChem CID | 54580835 |
| Molecular Formula | C11H23O6S+ |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (2R,3S,4S)-1-[(2S,3S)-3-ethoxy-2,4-dihydroxybutyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol |
| SMILES | CCO[C@@H](CO)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C11H23O6S/c1-2-17-9(3-12)7(14)5-18-6-8(15)11(16)10(18)4-13/h7-16H,2-6H2,1H3/q+1/t7-,8-,9+,10-,11+,18?/m1/s1 |
| InChIKey | BXFFSSJRPAOJST-XIIDIVBKSA-N |
| XLogP | -2.54 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|