C27H40N4O4S — CID 54580874
(2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide (PubChem CID 54580874) has the molecular formula C27H40N4O4S and a molecular weight of 516.71 g/mol. Its IUPAC name is (2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 54580874 |
| Molecular Formula | C27H40N4O4S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | (2S)-2-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]-N-[3-(4-methylpiperazin-1-yl)propyl]-3-phenylpropanamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)NCCCN2CCN(C)CC2)c(C)c1C |
| InChI | InChI=1S/C27H40N4O4S/c1-20-18-25(35-5)21(2)22(3)26(20)36(33,34)29-24(19-23-10-7-6-8-11-23)27(32)28-12-9-13-31-16-14-30(4)15-17-31/h6-8,10-11,18,24,29H,9,12-17,19H2,1-5H3,(H,28,32)/t24-/m0/s1 |
| InChIKey | OQXDJAIBJBOXEG-DEOSSOPVSA-N |
| XLogP | 2.26 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|