C17H15BrN2O4S — CID 54580900
ethyl 4-(6-bromo-4-oxochromen-3-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 54580900) has the molecular formula C17H15BrN2O4S and a molecular weight of 423.29 g/mol. Its IUPAC name is ethyl 4-(6-bromo-4-oxochromen-3-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(6-bromo-4-oxochromen-3-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 54580900 |
| Molecular Formula | C17H15BrN2O4S |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | ethyl 4-(6-bromo-4-oxochromen-3-yl)-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)NC1c1coc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H15BrN2O4S/c1-3-23-16(22)13-8(2)19-17(25)20-14(13)11-7-24-12-5-4-9(18)6-10(12)15(11)21/h4-7,14H,3H2,1-2H3,(H2,19,20,25) |
| InChIKey | WMEFWELWPGJMRA-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|