C17H14N6OS — CID 54580945
13-(2-methylprop-2-enylamino)-5-pyridin-4-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 54580945) has the molecular formula C17H14N6OS and a molecular weight of 350.41 g/mol. Its IUPAC name is 13-(2-methylprop-2-enylamino)-5-pyridin-4-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(2-methylprop-2-enylamino)-5-pyridin-4-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 54580945 |
| Molecular Formula | C17H14N6OS |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 13-(2-methylprop-2-enylamino)-5-pyridin-4-yl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | C=C(C)CNc1ncnc2sc3c(=O)n(-c4ccncc4)cnc3c12 |
| InChI | InChI=1S/C17H14N6OS/c1-10(2)7-19-15-12-13-14(25-16(12)21-8-20-15)17(24)23(9-22-13)11-3-5-18-6-4-11/h3-6,8-9H,1,7H2,2H3,(H,19,20,21) |
| InChIKey | JKQZJXLBDNOXFC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|