C23H22N4O6S — CID 54581031
3-[[9-[(3aS,4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-8-yl]sulfanylmethyl]chromen-2-one (PubChem CID 54581031) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is 3-[[9-[(3aS,4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-8-yl]sulfanylmethyl]chromen-2-one.
| Compound Name | 3-[[9-[(3aS,4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-8-yl]sulfanylmethyl]chromen-2-one |
|---|---|
| PubChem CID | 54581031 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 3-[[9-[(3aS,4R,6R,6aS)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]purin-8-yl]sulfanylmethyl]chromen-2-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](n1c(SCc3cc4ccccc4oc3=O)nc3cncnc31)O[C@@H]2CO |
| InChI | InChI=1S/C23H22N4O6S/c1-23(2)32-17-16(9-28)30-20(18(17)33-23)27-19-14(8-24-11-25-19)26-22(27)34-10-13-7-12-5-3-4-6-15(12)31-21(13)29/h3-8,11,16-18,20,28H,9-10H2,1-2H3/t16-,17+,18+,20-/m1/s1 |
| InChIKey | SFPGDKXKCUKWHG-DOADOZAASA-N |
| XLogP | 2.63 |
| TPSA | 121.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|