About 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione
6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 54581116) has the molecular formula C24H25N3O2
and a molecular weight of 387.48 g/mol. Its IUPAC name is 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione.
Molecular Properties
| Compound Name | 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
| PubChem CID | 54581116 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CN1CCN(CCCn2c3c(c4ccccc4c2=O)C(=O)c2ccccc2-3)CC1 |
| InChI | InChI=1S/C24H25N3O2/c1-25-13-15-26(16-14-25)11-6-12-27-22-18-8-3-4-9-19(18)23(28)21(22)17-7-2-5-10-20(17)24(27)29/h2-5,7-10H,6,11-16H2,1H3 |
| InChIKey | SHVOUJYJAODKDX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione?
The IUPAC name of 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione (CID 54581116) is 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione.
What is the SMILES notation for 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione?
The canonical SMILES for 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione is CN1CCN(CCCn2c3c(c4ccccc4c2=O)C(=O)c2ccccc2-3)CC1.
What is the InChIKey of 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione?
The InChIKey is SHVOUJYJAODKDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O2/c1-25-13-15-26(16-14-25)11-6-12-27-22-18-8-3-4-9-19(18)23(28)21(22)17-7-2-5-10-20(17)24(27)29/h2-5,7-10H,6,11-16H2,1H3.
What are the key properties of 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione?
6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione has a molecular weight of 387.48 g/mol, XLogP of 2.85, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(4-methylpiperazin-1-yl)propyl]indeno[1,2-c]isoquinoline-5,11-dione is sourced from PubChem (CID 54581116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).