C23H21F6NO6 — CID 54581200
4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7,10-dimethoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one (PubChem CID 54581200) has the molecular formula C23H21F6NO6 and a molecular weight of 521.41 g/mol. Its IUPAC name is 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7,10-dimethoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one.
| Compound Name | 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7,10-dimethoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one |
|---|---|
| PubChem CID | 54581200 |
| Molecular Formula | C23H21F6NO6 |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 4-butyl-11-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-7,10-dimethoxy-[1,3]dioxolo[4,5-c]phenanthridin-5-one |
| SMILES | CCCCn1c(=O)c2cc(OC)ccc2c2c(OC)c(C(O)(C(F)(F)F)C(F)(F)F)c3c(c21)OCO3 |
| InChI | InChI=1S/C23H21F6NO6/c1-4-5-8-30-16-14(12-7-6-11(33-2)9-13(12)20(30)31)17(34-3)15(18-19(16)36-10-35-18)21(32,22(24,25)26)23(27,28)29/h6-7,9,32H,4-5,8,10H2,1-3H3 |
| InChIKey | WOFAKYZCGNOULJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|