C19H22O7 — CID 54581281
(1S,2R,4R,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-10,15-dimethyl-5-propan-2-yl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione (PubChem CID 54581281) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is (1S,2R,4R,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-10,15-dimethyl-5-propan-2-yl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione.
| Compound Name | (1S,2R,4R,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-10,15-dimethyl-5-propan-2-yl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione |
|---|---|
| PubChem CID | 54581281 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (1S,2R,4R,5R,10S,11S,13R,14R,15R,18R)-14-hydroxy-10,15-dimethyl-5-propan-2-yl-3,6,12,17-tetraoxahexacyclo[8.7.1.02,4.04,9.011,13.015,18]octadec-8-ene-7,16-dione |
| SMILES | CC(C)C1OC(=O)C=C2[C@]3(C)[C@H]4[C@H](OC(=O)[C@@]4(C)[C@@H](O)[C@H]4O[C@H]43)[C@H]3O[C@]213 |
| InChI | InChI=1S/C19H22O7/c1-6(2)13-19-7(5-8(20)23-13)17(3)11-9(15(19)26-19)25-16(22)18(11,4)12(21)10-14(17)24-10/h5-6,9-15,21H,1-4H3/t9-,10+,11+,12-,13?,14+,15+,17+,18+,19+/m0/s1 |
| InChIKey | JGSUCIMBMLTPHC-VEYUNVFKSA-N |
| XLogP | 0.34 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|