About N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine
N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine (PubChem CID 54581290) has the molecular formula C25H22N8O
and a molecular weight of 450.51 g/mol. Its IUPAC name is N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine.
Molecular Properties
| Compound Name | N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine |
| PubChem CID | 54581290 |
| Molecular Formula | C25H22N8O |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine |
| SMILES | c1cncc(-c2ccc3cnc(Nc4ccc(-n5cnc(N6CCOCC6)n5)cc4)nc3c2)c1 |
| InChI | InChI=1S/C25H22N8O/c1-2-19(15-26-9-1)18-3-4-20-16-27-24(30-23(20)14-18)29-21-5-7-22(8-6-21)33-17-28-25(31-33)32-10-12-34-13-11-32/h1-9,14-17H,10-13H2,(H,27,29,30) |
| InChIKey | VXMIYKLZMPPINV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine?
The IUPAC name of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine (CID 54581290) is N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine.
What is the SMILES notation for N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine?
The canonical SMILES for N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine is c1cncc(-c2ccc3cnc(Nc4ccc(-n5cnc(N6CCOCC6)n5)cc4)nc3c2)c1.
What is the InChIKey of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine?
The InChIKey is VXMIYKLZMPPINV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N8O/c1-2-19(15-26-9-1)18-3-4-20-16-27-24(30-23(20)14-18)29-21-5-7-22(8-6-21)33-17-28-25(31-33)32-10-12-34-13-11-32/h1-9,14-17H,10-13H2,(H,27,29,30).
What are the key properties of N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine?
N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine has a molecular weight of 450.51 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-morpholin-4-yl-1,2,4-triazol-1-yl)phenyl]-7-pyridin-3-ylquinazolin-2-amine is sourced from PubChem (CID 54581290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).