C24H25N3O3 — CID 54581333
9-amino-2-cyclopentyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one (PubChem CID 54581333) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 9-amino-2-cyclopentyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one.
| Compound Name | 9-amino-2-cyclopentyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one |
|---|---|
| PubChem CID | 54581333 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 9-amino-2-cyclopentyl-5-(2,5-dimethoxyphenyl)-3H-pyrrolo[3,4-b]quinolin-1-one |
| SMILES | COc1ccc(OC)c(-c2cccc3c(N)c4c(nc23)CN(C2CCCC2)C4=O)c1 |
| InChI | InChI=1S/C24H25N3O3/c1-29-15-10-11-20(30-2)18(12-15)16-8-5-9-17-22(25)21-19(26-23(16)17)13-27(24(21)28)14-6-3-4-7-14/h5,8-12,14H,3-4,6-7,13H2,1-2H3,(H2,25,26) |
| InChIKey | SUBCTDHFKBVAQE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |