C30H45BN4O7 — CID 54581440
[(1R)-3-methyl-1-[[(5S)-5-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid (PubChem CID 54581440) has the molecular formula C30H45BN4O7 and a molecular weight of 584.52 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(5S)-5-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(5S)-5-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 54581440 |
| Molecular Formula | C30H45BN4O7 |
| Molecular Weight | 584.52 g/mol |
| Exact Mass | 584.34 |
| IUPAC Name | [(1R)-3-methyl-1-[[(5S)-5-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(naphthalen-2-ylmethylamino)-6-oxohexanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CCC[C@H](NC(=O)[C@H](C)NC(=O)OC(C)(C)C)C(=O)NCc1ccc2ccccc2c1)B(O)O |
| InChI | InChI=1S/C30H45BN4O7/c1-19(2)16-25(31(40)41)35-26(36)13-9-12-24(34-27(37)20(3)33-29(39)42-30(4,5)6)28(38)32-18-21-14-15-22-10-7-8-11-23(22)17-21/h7-8,10-11,14-15,17,19-20,24-25,40-41H,9,12-13,16,18H2,1-6H3,(H,32,38)(H,33,39)(H,34,37)(H,35,36)/t20-,24-,25-/m0/s1 |
| InChIKey | ZNIJHHFPAPOJMI-OPXMRZJTSA-N |
| XLogP | 2.57 |
| TPSA | 166.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|