C36H39N5O4 — CID 54581744
(E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 54581744) has the molecular formula C36H39N5O4 and a molecular weight of 605.74 g/mol. Its IUPAC name is (E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54581744 |
| Molecular Formula | C36H39N5O4 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.30 |
| IUPAC Name | (E)-3-[4-[[(3S)-3-[(3-cyclohexyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]-1-methylpyrrolidine-3-carbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN1CC[C@@](NC(=O)c2ccc3c(C4CCCCC4)c(-c4ccccn4)n(C)c3c2)(C(=O)Nc2ccc(/C=C/C(=O)O)cc2)C1 |
| InChI | InChI=1S/C36H39N5O4/c1-40-21-19-36(23-40,35(45)38-27-15-11-24(12-16-27)13-18-31(42)43)39-34(44)26-14-17-28-30(22-26)41(2)33(29-10-6-7-20-37-29)32(28)25-8-4-3-5-9-25/h6-7,10-18,20,22,25H,3-5,8-9,19,21,23H2,1-2H3,(H,38,45)(H,39,44)(H,42,43)/b18-13+/t36-/m0/s1 |
| InChIKey | CTDKNICFSSBXEM-ZYUWMNDKSA-N |
| XLogP | 5.83 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|