C17H18ClFN4 — CID 54581850
8-fluoro-2-(2-pyrazin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride (PubChem CID 54581850) has the molecular formula C17H18ClFN4 and a molecular weight of 332.81 g/mol. Its IUPAC name is 8-fluoro-2-(2-pyrazin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride.
| Compound Name | 8-fluoro-2-(2-pyrazin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 54581850 |
| Molecular Formula | C17H18ClFN4 |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 8-fluoro-2-(2-pyrazin-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole;hydrochloride |
| SMILES | Cl.Fc1ccc2[nH]c3c(c2c1)CN(CCc1cnccn1)CC3 |
| InChI | InChI=1S/C17H17FN4.ClH/c18-12-1-2-16-14(9-12)15-11-22(8-4-17(15)21-16)7-3-13-10-19-5-6-20-13;/h1-2,5-6,9-10,21H,3-4,7-8,11H2;1H |
| InChIKey | DSLZPRNINBVMBG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|