C36H48F6N2O4 — CID 54581972
(4E,6Z,19Z,21Z,29S,30R)-1-aza-16-azoniatetracyclo[27.3.1.112,16.014,30]tetratriaconta-4,6,12,14,16(34),19,21-heptaene;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid (PubChem CID 54581972) has the molecular formula C36H48F6N2O4 and a molecular weight of 686.78 g/mol. Its IUPAC name is (4E,6Z,19Z,21Z,29S,30R)-1-aza-16-azoniatetracyclo[27.3.1.112,16.014,30]tetratriaconta-4,6,12,14,16(34),19,21-heptaene;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid.
| Compound Name | (4E,6Z,19Z,21Z,29S,30R)-1-aza-16-azoniatetracyclo[27.3.1.112,16.014,30]tetratriaconta-4,6,12,14,16(34),19,21-heptaene;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 54581972 |
| Molecular Formula | C36H48F6N2O4 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 686.35 |
| IUPAC Name | (4E,6Z,19Z,21Z,29S,30R)-1-aza-16-azoniatetracyclo[27.3.1.112,16.014,30]tetratriaconta-4,6,12,14,16(34),19,21-heptaene;2,2,2-trifluoroacetate;2,2,2-trifluoroacetic acid |
| SMILES | C1=C\CCCCCC[C@@H]2CN3CC/C=C\C=C/CCCCc4cc(c[n+](c4)CC\C=C/1)[C@@H]2CC3.O=C(O)C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C32H47N2.2C2HF3O2/c1-2-5-10-14-18-23-34-26-29-19-15-11-7-4-6-9-13-17-22-33-24-21-32(31(25-29)28-34)30(27-33)20-16-12-8-3-1;2*3-2(4,5)1(6)7/h2,4-6,9-10,13-14,25-26,28,30,32H,1,3,7-8,11-12,15-24,27H2;2*(H,6,7)/q+1;;/p-1/b5-2-,6-4-,13-9-,14-10-;;/t30-,32-;;/m1../s1 |
| InChIKey | HTYPMRCGHQFGBU-MNABKXGASA-M |
| XLogP | 7.40 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|