C25H32N4 — CID 54582000
8-methyl-2-(1-methylpiperidin-4-yl)-5-(2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 54582000) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is 8-methyl-2-(1-methylpiperidin-4-yl)-5-(2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 8-methyl-2-(1-methylpiperidin-4-yl)-5-(2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 54582000 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 8-methyl-2-(1-methylpiperidin-4-yl)-5-(2-pyridin-3-ylethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2cccnc2)CCN(C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C25H32N4/c1-19-5-6-24-22(16-19)23-18-28(21-8-12-27(2)13-9-21)14-10-25(23)29(24)15-7-20-4-3-11-26-17-20/h3-6,11,16-17,21H,7-10,12-15,18H2,1-2H3 |
| InChIKey | BDDPDGBPFDDYBY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|