C18H15N5OS — CID 54582003
13-(2-methylprop-2-enylamino)-5-phenyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one (PubChem CID 54582003) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is 13-(2-methylprop-2-enylamino)-5-phenyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one.
| Compound Name | 13-(2-methylprop-2-enylamino)-5-phenyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
|---|---|
| PubChem CID | 54582003 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 13-(2-methylprop-2-enylamino)-5-phenyl-8-thia-3,5,10,12-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,9,11-pentaen-6-one |
| SMILES | C=C(C)CNc1ncnc2sc3c(=O)n(-c4ccccc4)cnc3c12 |
| InChI | InChI=1S/C18H15N5OS/c1-11(2)8-19-16-13-14-15(25-17(13)21-9-20-16)18(24)23(10-22-14)12-6-4-3-5-7-12/h3-7,9-10H,1,8H2,2H3,(H,19,20,21) |
| InChIKey | OUMPJKLCJUSVBG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|