C23H37NO10 — CID 54582186
(Z)-but-2-enedioic acid;2-[2-[[(1R,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethylamino]ethanol (PubChem CID 54582186) has the molecular formula C23H37NO10 and a molecular weight of 487.55 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-[2-[[(1R,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethylamino]ethanol.
| Compound Name | (Z)-but-2-enedioic acid;2-[2-[[(1R,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 54582186 |
| Molecular Formula | C23H37NO10 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-[2-[[(1R,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]oxy]ethylamino]ethanol |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@@H](OCCNCCO)O[C@@H]3O[C@@]4(C)CCC1[C@@]23OO4.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H33NO6.C4H4O4/c1-12-4-5-15-13(2)16(22-11-9-20-8-10-21)23-17-19(15)14(12)6-7-18(3,24-17)25-26-19;5-3(6)1-2-4(7)8/h12-17,20-21H,4-11H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t12-,13-,14?,15?,16+,17-,18-,19-;/m1./s1 |
| InChIKey | ARIMWHQAZXFHOJ-WLTSXLRKSA-N |
| XLogP | 1.50 |
| TPSA | 153.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|