About 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one
1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one (PubChem CID 54582203) has the molecular formula C28H25F2N3O2
and a molecular weight of 473.52 g/mol. Its IUPAC name is 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one.
Molecular Properties
| Compound Name | 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one |
| PubChem CID | 54582203 |
| Molecular Formula | C28H25F2N3O2 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one |
| SMILES | CC1C(=O)C(C)C(c2cccc(F)c2)N(C(=O)Cn2cnc3ccccc32)C1c1cccc(F)c1 |
| InChI | InChI=1S/C28H25F2N3O2/c1-17-26(19-7-5-9-21(29)13-19)33(25(34)15-32-16-31-23-11-3-4-12-24(23)32)27(18(2)28(17)35)20-8-6-10-22(30)14-20/h3-14,16-18,26-27H,15H2,1-2H3 |
| InChIKey | LAWYXLAHNUVBTP-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one?
The IUPAC name of 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one (CID 54582203) is 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one.
What is the SMILES notation for 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one?
The canonical SMILES for 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one is CC1C(=O)C(C)C(c2cccc(F)c2)N(C(=O)Cn2cnc3ccccc32)C1c1cccc(F)c1.
What is the InChIKey of 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one?
The InChIKey is LAWYXLAHNUVBTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25F2N3O2/c1-17-26(19-7-5-9-21(29)13-19)33(25(34)15-32-16-31-23-11-3-4-12-24(23)32)27(18(2)28(17)35)20-8-6-10-22(30)14-20/h3-14,16-18,26-27H,15H2,1-2H3.
What are the key properties of 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one?
1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one has a molecular weight of 473.52 g/mol, XLogP of 5.48, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(benzimidazol-1-yl)acetyl]-2,6-bis(3-fluorophenyl)-3,5-dimethylpiperidin-4-one is sourced from PubChem (CID 54582203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).