C21H19F6NO3 — CID 54582227
5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methoxyphenanthridin-6-one (PubChem CID 54582227) has the molecular formula C21H19F6NO3 and a molecular weight of 447.38 g/mol. Its IUPAC name is 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methoxyphenanthridin-6-one.
| Compound Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methoxyphenanthridin-6-one |
|---|---|
| PubChem CID | 54582227 |
| Molecular Formula | C21H19F6NO3 |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4-methoxyphenanthridin-6-one |
| SMILES | CCCCn1c(=O)c2ccccc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)cc(OC)c21 |
| InChI | InChI=1S/C21H19F6NO3/c1-3-4-9-28-17-15(13-7-5-6-8-14(13)18(28)29)10-12(11-16(17)31-2)19(30,20(22,23)24)21(25,26)27/h5-8,10-11,30H,3-4,9H2,1-2H3 |
| InChIKey | YZYLAPSMVPVKOG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|