C21H17F6NO4 — CID 54582229
5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-j]phenanthridin-6-one (PubChem CID 54582229) has the molecular formula C21H17F6NO4 and a molecular weight of 461.36 g/mol. Its IUPAC name is 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-j]phenanthridin-6-one.
| Compound Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
|---|---|
| PubChem CID | 54582229 |
| Molecular Formula | C21H17F6NO4 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 5-butyl-2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-[1,3]dioxolo[4,5-j]phenanthridin-6-one |
| SMILES | CCCCn1c(=O)c2cc3c(cc2c2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21)OCO3 |
| InChI | InChI=1S/C21H17F6NO4/c1-2-3-6-28-15-5-4-11(19(30,20(22,23)24)21(25,26)27)7-13(15)12-8-16-17(32-10-31-16)9-14(12)18(28)29/h4-5,7-9,30H,2-3,6,10H2,1H3 |
| InChIKey | ABBDVHWEHHPSLE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|