C25H26FN3O2 — CID 54582249
[(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 54582249) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 54582249 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | [(4R,4aS,8aR)-4-hydroxy-4-phenyl-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-[3-(2-fluorophenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | O=C(c1cc(-c2ccccc2F)n[nH]1)N1CC[C@](O)(c2ccccc2)[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C25H26FN3O2/c26-20-12-6-4-10-18(20)21-16-22(28-27-21)24(30)29-15-14-25(31,17-8-2-1-3-9-17)19-11-5-7-13-23(19)29/h1-4,6,8-10,12,16,19,23,31H,5,7,11,13-15H2,(H,27,28)/t19-,23+,25-/m0/s1 |
| InChIKey | CDGLHYPUOWFNMC-CYSDGLOUSA-N |
| XLogP | 4.51 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |