C23H27NO4S — CID 54582250
[(4R,4aS,8aS)-4-hydroxy-4-(4-methylsulfonylphenyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone (PubChem CID 54582250) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is [(4R,4aS,8aS)-4-hydroxy-4-(4-methylsulfonylphenyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone.
| Compound Name | [(4R,4aS,8aS)-4-hydroxy-4-(4-methylsulfonylphenyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 54582250 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [(4R,4aS,8aS)-4-hydroxy-4-(4-methylsulfonylphenyl)-2,3,4a,5,6,7,8,8a-octahydroquinolin-1-yl]-phenylmethanone |
| SMILES | CS(=O)(=O)c1ccc([C@@]2(O)CCN(C(=O)c3ccccc3)[C@H]3CCCC[C@@H]32)cc1 |
| InChI | InChI=1S/C23H27NO4S/c1-29(27,28)19-13-11-18(12-14-19)23(26)15-16-24(21-10-6-5-9-20(21)23)22(25)17-7-3-2-4-8-17/h2-4,7-8,11-14,20-21,26H,5-6,9-10,15-16H2,1H3/t20-,21-,23-/m0/s1 |
| InChIKey | KTYDLESFGFDXDT-FUDKSRODSA-N |
| XLogP | 3.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |